C14H16N4O4S — CID 7675504
3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-propan-2-yl-1,2,4-triazole (PubChem CID 7675504) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 7675504 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1cnnc1SCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C14H16N4O4S/c1-9(2)17-7-15-16-14(17)23-6-11-4-12(18(19)20)3-10-5-21-8-22-13(10)11/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | BUADEYHNLGWJMQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|