C18H15N3O5S — CID 7816073
2-(4-methylphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 7816073) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-methylphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7816073 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-(4-methylphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-c2nnc(SCc3cc([N+](=O)[O-])cc4c3OCOC4)o2)cc1 |
| InChI | InChI=1S/C18H15N3O5S/c1-11-2-4-12(5-3-11)17-19-20-18(26-17)27-9-14-7-15(21(22)23)6-13-8-24-10-25-16(13)14/h2-7H,8-10H2,1H3 |
| InChIKey | MZDRXAPMLVOBSA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|