C16H14N2O7 — CID 41459080
8-[(5-methyl-2-nitrophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine (PubChem CID 41459080) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is 8-[(5-methyl-2-nitrophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-[(5-methyl-2-nitrophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 41459080 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 8-[(5-methyl-2-nitrophenoxy)methyl]-6-nitro-4H-1,3-benzodioxine |
| SMILES | Cc1ccc([N+](=O)[O-])c(OCc2cc([N+](=O)[O-])cc3c2OCOC3)c1 |
| InChI | InChI=1S/C16H14N2O7/c1-10-2-3-14(18(21)22)15(4-10)24-8-12-6-13(17(19)20)5-11-7-23-9-25-16(11)12/h2-6H,7-9H2,1H3 |
| InChIKey | RQGHXOONRSFUKU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|