C17H12Cl3NO7 — CID 16529679
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 16529679) has the molecular formula C17H12Cl3NO7 and a molecular weight of 448.64 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 16529679 |
| Molecular Formula | C17H12Cl3NO7 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C17H12Cl3NO7/c18-12-3-14(20)15(4-13(12)19)26-7-16(22)27-6-10-2-11(21(23)24)1-9-5-25-8-28-17(9)10/h1-4H,5-8H2 |
| InChIKey | QIWQFCCMBGWVRP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|