C16H17NO6 — CID 9065873
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S)-cyclopent-2-en-1-yl]acetate (PubChem CID 9065873) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S)-cyclopent-2-en-1-yl]acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S)-cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 9065873 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1S)-cyclopent-2-en-1-yl]acetate |
| SMILES | O=C(C[C@H]1C=CCC1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C16H17NO6/c18-15(5-11-3-1-2-4-11)22-9-13-7-14(17(19)20)6-12-8-21-10-23-16(12)13/h1,3,6-7,11H,2,4-5,8-10H2/t11-/m0/s1 |
| InChIKey | RURDKURDQDIXOB-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|