C15H15NO8S — CID 46642028
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate (PubChem CID 46642028) has the molecular formula C15H15NO8S and a molecular weight of 369.35 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
|---|---|
| PubChem CID | 46642028 |
| Molecular Formula | C15H15NO8S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
| SMILES | O=C(CC1C=CS(=O)(=O)C1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C15H15NO8S/c17-14(3-10-1-2-25(20,21)8-10)23-7-12-5-13(16(18)19)4-11-6-22-9-24-15(11)12/h1-2,4-5,10H,3,6-9H2 |
| InChIKey | LUYUIUIDNXRSNJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|