C18H21NO6 — CID 11932782
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11932782) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11932782 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C18H21NO6/c20-17(7-13-4-11-1-2-12(13)3-11)24-9-15-6-16(19(21)22)5-14-8-23-10-25-18(14)15/h5-6,11-13H,1-4,7-10H2/t11-,12+,13-/m0/s1 |
| InChIKey | PGAJFKIYKAPHGQ-XQQFMLRXSA-N |
| XLogP | 3.33 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|