C19H18BrNO6S — CID 4028780
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate (PubChem CID 4028780) has the molecular formula C19H18BrNO6S and a molecular weight of 468.33 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 4028780 |
| Molecular Formula | C19H18BrNO6S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetate |
| SMILES | Cc1cc(SCC(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)c(C)cc1Br |
| InChI | InChI=1S/C19H18BrNO6S/c1-11-4-17(12(2)3-16(11)20)28-9-18(22)26-8-14-6-15(21(23)24)5-13-7-25-10-27-19(13)14/h3-6H,7-10H2,1-2H3 |
| InChIKey | GDODSKFFOPROBQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|