C16H13BrN2O8 — CID 4035675
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 4035675) has the molecular formula C16H13BrN2O8 and a molecular weight of 441.19 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 4035675 |
| Molecular Formula | C16H13BrN2O8 |
| Molecular Weight | 441.19 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C16H13BrN2O8/c17-13-2-1-12(27-13)16(21)18-5-14(20)25-7-10-4-11(19(22)23)3-9-6-24-8-26-15(9)10/h1-4H,5-8H2,(H,18,21) |
| InChIKey | NLCSURIJCAYDIM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|