C18H14BrNO6 — CID 4617812
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(3-bromophenyl)prop-2-enoate (PubChem CID 4617812) has the molecular formula C18H14BrNO6 and a molecular weight of 420.22 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(3-bromophenyl)prop-2-enoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4617812 |
| Molecular Formula | C18H14BrNO6 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(3-bromophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(Br)c1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C18H14BrNO6/c19-15-3-1-2-12(6-15)4-5-17(21)25-10-14-8-16(20(22)23)7-13-9-24-11-26-18(13)14/h1-8H,9-11H2 |
| InChIKey | PRNDEVGNMBYEBZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|