C16H13BrN2O5 — CID 7702215
(Z)-1-(4-bromophenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]methanimine (PubChem CID 7702215) has the molecular formula C16H13BrN2O5 and a molecular weight of 393.19 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]methanimine.
| Compound Name | (Z)-1-(4-bromophenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 7702215 |
| Molecular Formula | C16H13BrN2O5 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]methanimine |
| SMILES | O=[N+]([O-])c1cc2c(c(CO/N=C\c3ccc(Br)cc3)c1)OCOC2 |
| InChI | InChI=1S/C16H13BrN2O5/c17-14-3-1-11(2-4-14)7-18-24-9-13-6-15(19(20)21)5-12-8-22-10-23-16(12)13/h1-7H,8-10H2/b18-7- |
| InChIKey | MBEAGHAIFXMCCF-WSVATBPTSA-N |
| XLogP | 3.77 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|