C21H19NO7 — CID 2613465
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 2613465) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2613465 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)cc1 |
| InChI | InChI=1S/C21H19NO7/c1-2-9-27-19-6-3-15(4-7-19)5-8-20(23)28-13-17-11-18(22(24)25)10-16-12-26-14-29-21(16)17/h2-8,10-11H,1,9,12-14H2/b8-5+ |
| InChIKey | JANPZAJUGOMBSS-VMPITWQZSA-N |
| XLogP | 3.78 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|