C19H15NO8 — CID 3264717
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 3264717) has the molecular formula C19H15NO8 and a molecular weight of 385.33 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3264717 |
| Molecular Formula | C19H15NO8 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C19H15NO8/c21-18(4-2-12-1-3-16-17(5-12)27-11-26-16)25-9-14-7-15(20(22)23)6-13-8-24-10-28-19(13)14/h1-7H,8-11H2 |
| InChIKey | QCYFBPSYJCFFBP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|