C19H18N2O8S — CID 2413497
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate (PubChem CID 2413497) has the molecular formula C19H18N2O8S and a molecular weight of 434.43 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 2413497 |
| Molecular Formula | C19H18N2O8S |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 2-[[(E)-2-phenylethenyl]sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)/C=C/c1ccccc1)OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C19H18N2O8S/c22-18(10-20-30(25,26)7-6-14-4-2-1-3-5-14)28-12-16-9-17(21(23)24)8-15-11-27-13-29-19(15)16/h1-9,20H,10-13H2/b7-6+ |
| InChIKey | POAJTPDEPQCGGK-VOTSOKGWSA-N |
| XLogP | 2.09 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|