C21H21NO8 — CID 26991842
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethoxy-5-prop-2-enylbenzoate (PubChem CID 26991842) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethoxy-5-prop-2-enylbenzoate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethoxy-5-prop-2-enylbenzoate |
|---|---|
| PubChem CID | 26991842 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethoxy-5-prop-2-enylbenzoate |
| SMILES | C=CCc1cc(C(=O)OCc2cc([N+](=O)[O-])cc3c2OCOC3)cc(OC)c1OC |
| InChI | InChI=1S/C21H21NO8/c1-4-5-13-6-14(9-18(26-2)20(13)27-3)21(23)29-11-16-8-17(22(24)25)7-15-10-28-12-30-19(15)16/h4,6-9H,1,5,10-12H2,2-3H3 |
| InChIKey | CCSJAMUAVQMSPG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|