C18H14ClNO8 — CID 7778799
3-O-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 7778799) has the molecular formula C18H14ClNO8 and a molecular weight of 407.76 g/mol. Its IUPAC name is 3-O-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7778799 |
| Molecular Formula | C18H14ClNO8 |
| Molecular Weight | 407.76 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 3-O-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl] 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCc2cc(Cl)cc3c2OCOC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClNO8/c1-25-17(21)10-2-11(6-15(5-10)20(23)24)18(22)27-8-13-4-14(19)3-12-7-26-9-28-16(12)13/h2-6H,7-9H2,1H3 |
| InChIKey | NOTGAYDHBWCDPE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|