C18H17ClO4 — CID 7794134
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethylbenzoate (PubChem CID 7794134) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethylbenzoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7794134 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2cc(Cl)cc3c2OCOC3)cc1C |
| InChI | InChI=1S/C18H17ClO4/c1-11-3-4-13(5-12(11)2)18(20)22-9-15-7-16(19)6-14-8-21-10-23-17(14)15/h3-7H,8-10H2,1-2H3 |
| InChIKey | CEJLPMPXOWCECB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |