C16H12ClFO4 — CID 7508664
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-fluorobenzoate (PubChem CID 7508664) has the molecular formula C16H12ClFO4 and a molecular weight of 322.72 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-fluorobenzoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 7508664 |
| Molecular Formula | C16H12ClFO4 |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 2-fluorobenzoate |
| SMILES | O=C(OCc1cc(Cl)cc2c1OCOC2)c1ccccc1F |
| InChI | InChI=1S/C16H12ClFO4/c17-12-5-10-7-20-9-22-15(10)11(6-12)8-21-16(19)13-3-1-2-4-14(13)18/h1-6H,7-9H2 |
| InChIKey | FWJOHUBTEBGWNF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |