C18H17ClO4 — CID 7364716
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-ethylbenzoate (PubChem CID 7364716) has the molecular formula C18H17ClO4 and a molecular weight of 332.78 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-ethylbenzoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-ethylbenzoate |
|---|---|
| PubChem CID | 7364716 |
| Molecular Formula | C18H17ClO4 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OCc2cc(Cl)cc3c2OCOC3)cc1 |
| InChI | InChI=1S/C18H17ClO4/c1-2-12-3-5-13(6-4-12)18(20)22-10-15-8-16(19)7-14-9-21-11-23-17(14)15/h3-8H,2,9-11H2,1H3 |
| InChIKey | SDDKTXFAYRLVCQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |