C23H17ClO5 — CID 7203869
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-benzoylbenzoate (PubChem CID 7203869) has the molecular formula C23H17ClO5 and a molecular weight of 408.84 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-benzoylbenzoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-benzoylbenzoate |
|---|---|
| PubChem CID | 7203869 |
| Molecular Formula | C23H17ClO5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-benzoylbenzoate |
| SMILES | O=C(OCc1cc(Cl)cc2c1OCOC2)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17ClO5/c24-20-10-18-12-27-14-29-22(18)19(11-20)13-28-23(26)17-8-6-16(7-9-17)21(25)15-4-2-1-3-5-15/h1-11H,12-14H2 |
| InChIKey | ZEILCTQANDKSQP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |