C25H22ClNO5 — CID 42970741
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-benzamido-3-phenylpropanoate (PubChem CID 42970741) has the molecular formula C25H22ClNO5 and a molecular weight of 451.91 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-benzamido-3-phenylpropanoate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 42970741 |
| Molecular Formula | C25H22ClNO5 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 3-benzamido-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C25H22ClNO5/c26-21-11-19-14-30-16-32-24(19)20(12-21)15-31-23(28)13-22(17-7-3-1-4-8-17)27-25(29)18-9-5-2-6-10-18/h1-12,22H,13-16H2,(H,27,29) |
| InChIKey | DMMLSPAWEHSQRP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |