C23H20ClNO3 — CID 18277631
(4-chlorophenyl)methyl 3-benzamido-3-phenylpropanoate (PubChem CID 18277631) has the molecular formula C23H20ClNO3 and a molecular weight of 393.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-benzamido-3-phenylpropanoate.
| Compound Name | (4-chlorophenyl)methyl 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 18277631 |
| Molecular Formula | C23H20ClNO3 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | (4-chlorophenyl)methyl 3-benzamido-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClNO3/c24-20-13-11-17(12-14-20)16-28-22(26)15-21(18-7-3-1-4-8-18)25-23(27)19-9-5-2-6-10-19/h1-14,21H,15-16H2,(H,25,27) |
| InChIKey | GARFFAJSBCGUTK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |