C17H17ClN2O3 — CID 8608690
benzyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8608690) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is benzyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | benzyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8608690 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | benzyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | NC(=O)N[C@@H](CC(=O)OCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O3/c18-14-8-6-13(7-9-14)15(20-17(19)22)10-16(21)23-11-12-4-2-1-3-5-12/h1-9,15H,10-11H2,(H3,19,20,22)/t15-/m0/s1 |
| InChIKey | PCHSXNJJIBXXSG-HNNXBMFYSA-N |
| XLogP | 3.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |