C13H17ClN2O3 — CID 43020953
propyl 3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 43020953) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is propyl 3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | propyl 3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 43020953 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | propyl 3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | CCCOC(=O)CC(NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-2-7-19-12(17)8-11(16-13(15)18)9-3-5-10(14)6-4-9/h3-6,11H,2,7-8H2,1H3,(H3,15,16,18) |
| InChIKey | CQZHHDXFBBRHHH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |