C20H23ClN2O5 — CID 8607008
2-(4-ethoxyphenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8607008) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8607008 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | CCOc1ccc(OCCOC(=O)C[C@H](NC(N)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2O5/c1-2-26-16-7-9-17(10-8-16)27-11-12-28-19(24)13-18(23-20(22)25)14-3-5-15(21)6-4-14/h3-10,18H,2,11-13H2,1H3,(H3,22,23,25)/t18-/m0/s1 |
| InChIKey | HRXSJTWIMMBHMJ-SFHVURJKSA-N |
| XLogP | 3.46 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|