C18H18Cl2N2O4 — CID 8606683
2-(4-chlorophenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8606683) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8606683 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | NC(=O)N[C@@H](CC(=O)OCCOc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O4/c19-13-3-1-12(2-4-13)16(22-18(21)24)11-17(23)26-10-9-25-15-7-5-14(20)6-8-15/h1-8,16H,9-11H2,(H3,21,22,24)/t16-/m0/s1 |
| InChIKey | RNAWVOLAAYPVQV-INIZCTEOSA-N |
| XLogP | 3.72 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|