C16H22ClN3O4 — CID 8607324
[2-(tert-butylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8607324) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8607324 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)C[C@H](NC(N)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O4/c1-16(2,3)20-13(21)9-24-14(22)8-12(19-15(18)23)10-4-6-11(17)7-5-10/h4-7,12H,8-9H2,1-3H3,(H,20,21)(H3,18,19,23)/t12-/m0/s1 |
| InChIKey | LLCYQKALIVYCNV-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |