C17H16Cl2N2O3 — CID 8608684
(4-chlorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8608684) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | (4-chlorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8608684 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (4-chlorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | NC(=O)N[C@@H](CC(=O)OCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-13-5-1-11(2-6-13)10-24-16(22)9-15(21-17(20)23)12-3-7-14(19)8-4-12/h1-8,15H,9-10H2,(H3,20,21,23)/t15-/m0/s1 |
| InChIKey | VALCBUBRQAOTQQ-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |