C17H15Cl2FN2O3 — CID 8608777
(2-chloro-6-fluorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8608777) has the molecular formula C17H15Cl2FN2O3 and a molecular weight of 385.22 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8608777 |
| Molecular Formula | C17H15Cl2FN2O3 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl (3S)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | NC(=O)N[C@@H](CC(=O)OCc1c(F)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2FN2O3/c18-11-6-4-10(5-7-11)15(22-17(21)24)8-16(23)25-9-12-13(19)2-1-3-14(12)20/h1-7,15H,8-9H2,(H3,21,22,24)/t15-/m0/s1 |
| InChIKey | RZPMJXRJSOCQDL-HNNXBMFYSA-N |
| XLogP | 3.98 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |