C16H16ClN3O4 — CID 8607628
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate (PubChem CID 8607628) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 8607628 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)propanoate |
| SMILES | NC(=O)N[C@H](CC(=O)OCC(=O)c1ccc[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O4/c17-11-5-3-10(4-6-11)13(20-16(18)23)8-15(22)24-9-14(21)12-2-1-7-19-12/h1-7,13,19H,8-9H2,(H3,18,20,23)/t13-/m1/s1 |
| InChIKey | CPWFBJXHEHPZHR-CYBMUJFWSA-N |
| XLogP | 2.19 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |