C15H15ClN2O5S — CID 2467735
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 2467735) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2467735 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(Cl)cc1)OCC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H15ClN2O5S/c16-11-3-5-12(6-4-11)24(21,22)18-9-7-15(20)23-10-14(19)13-2-1-8-17-13/h1-6,8,17-18H,7,9-10H2 |
| InChIKey | CBPYHIPJZGKHCQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |