C19H17ClN2O5S — CID 41035639
[2-(1H-indol-3-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate (PubChem CID 41035639) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 41035639 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17ClN2O5S/c20-13-4-3-5-14(10-13)28(25,26)22-9-8-19(24)27-12-18(23)16-11-21-17-7-2-1-6-15(16)17/h1-7,10-11,21-22H,8-9,12H2 |
| InChIKey | PLFJDHAWZZDXGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |