C15H14ClFN2O5S — CID 7414322
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 7414322) has the molecular formula C15H14ClFN2O5S and a molecular weight of 388.80 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7414322 |
| Molecular Formula | C15H14ClFN2O5S |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-[(3-chloro-4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)c(Cl)c1)OCC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H14ClFN2O5S/c16-11-8-10(3-4-12(11)17)25(22,23)19-7-5-15(21)24-9-14(20)13-2-1-6-18-13/h1-4,6,8,18-19H,5,7,9H2 |
| InChIKey | MDVZNLPMPHXTMF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |