C15H13Cl2NO5S2 — CID 41035928
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate (PubChem CID 41035928) has the molecular formula C15H13Cl2NO5S2 and a molecular weight of 422.31 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 41035928 |
| Molecular Formula | C15H13Cl2NO5S2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[(3-chlorophenyl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(Cl)c1)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H13Cl2NO5S2/c16-10-2-1-3-11(8-10)25(21,22)18-7-6-15(20)23-9-12(19)13-4-5-14(17)24-13/h1-5,8,18H,6-7,9H2 |
| InChIKey | FOYWRVRWUYSYAO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |