C20H22ClNO7S2 — CID 2404708
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate (PubChem CID 2404708) has the molecular formula C20H22ClNO7S2 and a molecular weight of 487.98 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 2404708 |
| Molecular Formula | C20H22ClNO7S2 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H22ClNO7S2/c21-19-8-7-18(30-19)15(23)13-29-20(24)4-2-1-3-9-22-31(25,26)14-5-6-16-17(12-14)28-11-10-27-16/h5-8,12,22H,1-4,9-11,13H2 |
| InChIKey | VNOGMPFLMKXUDE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|