C18H28N2O5S — CID 30780673
N-tert-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 30780673) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-tert-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-tert-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 30780673 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-tert-butyl-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | CC(C)(C)NC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H28N2O5S/c1-18(2,3)20-17(21)7-5-4-6-10-19-26(22,23)14-8-9-15-16(13-14)25-12-11-24-15/h8-9,13,19H,4-7,10-12H2,1-3H3,(H,20,21) |
| InChIKey | GOYBVSTYJGGCCG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|