C23H35N3O6S — CID 55952589
N-[3-(cyclohexylamino)-3-oxopropyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 55952589) has the molecular formula C23H35N3O6S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)-3-oxopropyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-[3-(cyclohexylamino)-3-oxopropyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 55952589 |
| Molecular Formula | C23H35N3O6S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[3-(cyclohexylamino)-3-oxopropyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)NCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H35N3O6S/c27-22(24-14-12-23(28)26-18-7-3-1-4-8-18)9-5-2-6-13-25-33(29,30)19-10-11-20-21(17-19)32-16-15-31-20/h10-11,17-18,25H,1-9,12-16H2,(H,24,27)(H,26,28) |
| InChIKey | NMOLOWRGVXELQG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|