C21H34N2O5S — CID 30381788
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2S)-heptan-2-yl]hexanamide (PubChem CID 30381788) has the molecular formula C21H34N2O5S and a molecular weight of 426.58 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2S)-heptan-2-yl]hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2S)-heptan-2-yl]hexanamide |
|---|---|
| PubChem CID | 30381788 |
| Molecular Formula | C21H34N2O5S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-[(2S)-heptan-2-yl]hexanamide |
| SMILES | CCCCC[C@H](C)NC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H34N2O5S/c1-3-4-6-9-17(2)23-21(24)10-7-5-8-13-22-29(25,26)18-11-12-19-20(16-18)28-15-14-27-19/h11-12,16-17,22H,3-10,13-15H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | KLGVPISMYSCTNZ-KRWDZBQOSA-N |
| XLogP | 3.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|