C23H28F2N2O6S — CID 46476729
N-[1-[3-(difluoromethoxy)phenyl]ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide (PubChem CID 46476729) has the molecular formula C23H28F2N2O6S and a molecular weight of 498.55 g/mol. Its IUPAC name is N-[1-[3-(difluoromethoxy)phenyl]ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide.
| Compound Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
|---|---|
| PubChem CID | 46476729 |
| Molecular Formula | C23H28F2N2O6S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[1-[3-(difluoromethoxy)phenyl]ethyl]-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanamide |
| SMILES | CC(NC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C23H28F2N2O6S/c1-16(17-6-5-7-18(14-17)33-23(24)25)27-22(28)8-3-2-4-11-26-34(29,30)19-9-10-20-21(15-19)32-13-12-31-20/h5-7,9-10,14-16,23,26H,2-4,8,11-13H2,1H3,(H,27,28) |
| InChIKey | LMRSPAWNOGARSB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|