C24H32N2O6S — CID 55945947
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-methyl-4-propan-2-yloxyphenyl)hexanamide (PubChem CID 55945947) has the molecular formula C24H32N2O6S and a molecular weight of 476.60 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-methyl-4-propan-2-yloxyphenyl)hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-methyl-4-propan-2-yloxyphenyl)hexanamide |
|---|---|
| PubChem CID | 55945947 |
| Molecular Formula | C24H32N2O6S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-methyl-4-propan-2-yloxyphenyl)hexanamide |
| SMILES | Cc1cc(OC(C)C)ccc1NC(=O)CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H32N2O6S/c1-17(2)32-19-8-10-21(18(3)15-19)26-24(27)7-5-4-6-12-25-33(28,29)20-9-11-22-23(16-20)31-14-13-30-22/h8-11,15-17,25H,4-7,12-14H2,1-3H3,(H,26,27) |
| InChIKey | PQYVCATXIZHLIW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|