C21H26N2O6S — CID 26561486
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(4-ethoxyphenyl)butanamide (PubChem CID 26561486) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(4-ethoxyphenyl)butanamide.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(4-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 26561486 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(4-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccc(NC(=O)CCCNS(=O)(=O)c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-2-27-17-8-6-16(7-9-17)23-21(24)5-3-12-22-30(25,26)18-10-11-19-20(15-18)29-14-4-13-28-19/h6-11,15,22H,2-5,12-14H2,1H3,(H,23,24) |
| InChIKey | CMDUXVKECQFTJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|