C22H26N2O5S — CID 24637640
4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-5-yl)butanamide (PubChem CID 24637640) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-5-yl)butanamide.
| Compound Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-5-yl)butanamide |
|---|---|
| PubChem CID | 24637640 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-5-yl)butanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCCO2)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H26N2O5S/c25-22(24-18-8-7-16-4-1-5-17(16)14-18)6-2-11-23-30(26,27)19-9-10-20-21(15-19)29-13-3-12-28-20/h7-10,14-15,23H,1-6,11-13H2,(H,24,25) |
| InChIKey | RXENDYKASDELKR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|