C23H25N3O7S — CID 55691896
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]propanamide (PubChem CID 55691896) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]propanamide.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55691896 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)OCCCO2)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C23H25N3O7S/c27-21(25-16-5-7-17(8-6-16)26-22(28)3-1-4-23(26)29)11-12-24-34(30,31)18-9-10-19-20(15-18)33-14-2-13-32-19/h5-10,15,24H,1-4,11-14H2,(H,25,27) |
| InChIKey | PCWBGKVPDRKJGU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|