C23H29NO8S — CID 55322667
2-(4-propoxyphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 55322667) has the molecular formula C23H29NO8S and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-(4-propoxyphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | 2-(4-propoxyphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 55322667 |
| Molecular Formula | C23H29NO8S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-(4-propoxyphenoxy)ethyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | CCCOc1ccc(OCCOC(=O)CCCNS(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C23H29NO8S/c1-2-12-28-18-5-7-19(8-6-18)29-13-16-32-23(25)4-3-11-24-33(26,27)20-9-10-21-22(17-20)31-15-14-30-21/h5-10,17,24H,2-4,11-16H2,1H3 |
| InChIKey | ZHOJIWUCCHAFHE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|