C19H19Cl2NO6S — CID 32831876
(2,4-dichlorophenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 32831876) has the molecular formula C19H19Cl2NO6S and a molecular weight of 460.34 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | (2,4-dichlorophenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 32831876 |
| Molecular Formula | C19H19Cl2NO6S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | (2,4-dichlorophenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO6S/c20-14-4-3-13(16(21)10-14)12-28-19(23)2-1-7-22-29(24,25)15-5-6-17-18(11-15)27-9-8-26-17/h3-6,10-11,22H,1-2,7-9,12H2 |
| InChIKey | ZJOWIZQKSUYXQY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|