C22H23N3O6S — CID 34792752
(4-pyrazol-1-ylphenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate (PubChem CID 34792752) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is (4-pyrazol-1-ylphenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate.
| Compound Name | (4-pyrazol-1-ylphenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 34792752 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (4-pyrazol-1-ylphenyl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)butanoate |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c26-22(31-16-17-4-6-18(7-5-17)25-12-2-10-23-25)3-1-11-24-32(27,28)19-8-9-20-21(15-19)30-14-13-29-20/h2,4-10,12,15,24H,1,3,11,13-14,16H2 |
| InChIKey | PORBXMVEKJXYRI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|