C23H27NO8S — CID 35521425
methyl 3-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoyloxymethyl]benzoate (PubChem CID 35521425) has the molecular formula C23H27NO8S and a molecular weight of 477.54 g/mol. Its IUPAC name is methyl 3-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoyloxymethyl]benzoate.
| Compound Name | methyl 3-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 35521425 |
| Molecular Formula | C23H27NO8S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | methyl 3-[6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoyloxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C23H27NO8S/c1-29-23(26)18-7-5-6-17(14-18)16-32-22(25)8-3-2-4-11-24-33(27,28)19-9-10-20-21(15-19)31-13-12-30-20/h5-7,9-10,14-15,24H,2-4,8,11-13,16H2,1H3 |
| InChIKey | URXNMPBFLDPNLJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|