C21H24N2O8S — CID 35521413
(2-nitrophenyl)methyl 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate (PubChem CID 35521413) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate.
| Compound Name | (2-nitrophenyl)methyl 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 35521413 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (2-nitrophenyl)methyl 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O8S/c24-21(31-15-16-6-3-4-7-18(16)23(25)26)8-2-1-5-11-22-32(27,28)17-9-10-19-20(14-17)30-13-12-29-19/h3-4,6-7,9-10,14,22H,1-2,5,8,11-13,15H2 |
| InChIKey | UQJOPAPJTIHABT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|