C24H29NO7S — CID 3407201
[2-(2,5-dimethylphenyl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate (PubChem CID 3407201) has the molecular formula C24H29NO7S and a molecular weight of 475.56 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 3407201 |
| Molecular Formula | C24H29NO7S |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C24H29NO7S/c1-17-7-8-18(2)20(14-17)21(26)16-32-24(27)6-4-3-5-11-25-33(28,29)19-9-10-22-23(15-19)31-13-12-30-22/h7-10,14-15,25H,3-6,11-13,16H2,1-2H3 |
| InChIKey | ZBOQUVOZEVBSKW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|