C24H32N2O7S — CID 30556391
[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate (PubChem CID 30556391) has the molecular formula C24H32N2O7S and a molecular weight of 492.59 g/mol. Its IUPAC name is [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate.
| Compound Name | [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
|---|---|
| PubChem CID | 30556391 |
| Molecular Formula | C24H32N2O7S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)hexanoate |
| SMILES | CCn1c(C)cc(C(=O)COC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)c1C |
| InChI | InChI=1S/C24H32N2O7S/c1-4-26-17(2)14-20(18(26)3)21(27)16-33-24(28)8-6-5-7-11-25-34(29,30)19-9-10-22-23(15-19)32-13-12-31-22/h9-10,14-15,25H,4-8,11-13,16H2,1-3H3 |
| InChIKey | YJYZYVHMDSWEDJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|